C11H11ClN4O3 — CID 78969253
N-(2-chloro-4,5-dimethoxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 78969253) has the molecular formula C11H11ClN4O3 and a molecular weight of 282.69 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 78969253 |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | COc1cc(Cl)c(NC(=O)c2cn[nH]n2)cc1OC |
| InChI | InChI=1S/C11H11ClN4O3/c1-18-9-3-6(12)7(4-10(9)19-2)14-11(17)8-5-13-16-15-8/h3-5H,1-2H3,(H,14,17)(H,13,15,16) |
| InChIKey | GXOXARLYJHVMEV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |