C12H13ClN2O — CID 78969978
3-(4-chlorophenyl)-1-ethyl-1-prop-2-ynylurea (PubChem CID 78969978) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-ethyl-1-prop-2-ynylurea.
| Compound Name | 3-(4-chlorophenyl)-1-ethyl-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 78969978 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-ethyl-1-prop-2-ynylurea |
| SMILES | C#CCN(CC)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O/c1-3-9-15(4-2)12(16)14-11-7-5-10(13)6-8-11/h1,5-8H,4,9H2,2H3,(H,14,16) |
| InChIKey | MLUXXCRBYIIZSO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|