About 3-(decylamino)-1,1,1-trifluoropropan-2-ol
3-(decylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 78971582) has the molecular formula C13H26F3NO
and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-(decylamino)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(decylamino)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 78971582 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 3-(decylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCCCCCCCCNCC(O)C(F)(F)F |
| InChI | InChI=1S/C13H26F3NO/c1-2-3-4-5-6-7-8-9-10-17-11-12(18)13(14,15)16/h12,17-18H,2-11H2,1H3 |
| InChIKey | NLZXWAPSKLJZPF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(decylamino)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(decylamino)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-(decylamino)-1,1,1-trifluoropropan-2-ol (CID 78971582) is 3-(decylamino)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-(decylamino)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-(decylamino)-1,1,1-trifluoropropan-2-ol is CCCCCCCCCCNCC(O)C(F)(F)F.
What is the InChIKey of 3-(decylamino)-1,1,1-trifluoropropan-2-ol?
The InChIKey is NLZXWAPSKLJZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F3NO/c1-2-3-4-5-6-7-8-9-10-17-11-12(18)13(14,15)16/h12,17-18H,2-11H2,1H3.
What are the key properties of 3-(decylamino)-1,1,1-trifluoropropan-2-ol?
3-(decylamino)-1,1,1-trifluoropropan-2-ol has a molecular weight of 269.35 g/mol, XLogP of 3.64, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(decylamino)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 78971582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).