C9H17N3O4 — CID 78972686
(2R)-2-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]propanoic acid (PubChem CID 78972686) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2R)-2-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 78972686 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (2R)-2-[[[2-(dimethylamino)-2-oxoethyl]-methylcarbamoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)N(C)CC(=O)N(C)C)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-6(8(14)15)10-9(16)12(4)5-7(13)11(2)3/h6H,5H2,1-4H3,(H,10,16)(H,14,15)/t6-/m1/s1 |
| InChIKey | KIVDLNOXCKNINR-ZCFIWIBFSA-N |
| XLogP | -0.81 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |