C16H18N2O2 — CID 78973374
(2R)-2-amino-N-[2-(3-methylphenoxy)phenyl]propanamide (PubChem CID 78973374) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(3-methylphenoxy)phenyl]propanamide.
| Compound Name | (2R)-2-amino-N-[2-(3-methylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 78973374 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (2R)-2-amino-N-[2-(3-methylphenoxy)phenyl]propanamide |
| SMILES | Cc1cccc(Oc2ccccc2NC(=O)[C@@H](C)N)c1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-6-5-7-13(10-11)20-15-9-4-3-8-14(15)18-16(19)12(2)17/h3-10,12H,17H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | CHJIZZZSZXRMJU-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |