C10H17N3O — CID 78974832
1-cyano-N',N'-dimethylcyclohexane-1-carbohydrazide (PubChem CID 78974832) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-cyano-N',N'-dimethylcyclohexane-1-carbohydrazide.
| Compound Name | 1-cyano-N',N'-dimethylcyclohexane-1-carbohydrazide |
|---|---|
| PubChem CID | 78974832 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-cyano-N',N'-dimethylcyclohexane-1-carbohydrazide |
| SMILES | CN(C)NC(=O)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C10H17N3O/c1-13(2)12-9(14)10(8-11)6-4-3-5-7-10/h3-7H2,1-2H3,(H,12,14) |
| InChIKey | FLRRRUABWXDBEP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|