C16H22N2O3 — CID 78976000
(2R)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-4-methylpentanoic acid (PubChem CID 78976000) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-4-methylpentanoic acid.
| Compound Name | (2R)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78976000 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)Nc1ccc2c(c1)CCC2)C(=O)O |
| InChI | InChI=1S/C16H22N2O3/c1-10(2)8-14(15(19)20)18-16(21)17-13-7-6-11-4-3-5-12(11)9-13/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,19,20)(H2,17,18,21)/t14-/m1/s1 |
| InChIKey | SMHTZTLXPRHHTA-CQSZACIVSA-N |
| XLogP | 2.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |