C14H25N3O3 — CID 78976412
(2R)-2-[[2-cyanoethyl(2-methylpropyl)carbamoyl]amino]-4-methylpentanoic acid (PubChem CID 78976412) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2R)-2-[[2-cyanoethyl(2-methylpropyl)carbamoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-cyanoethyl(2-methylpropyl)carbamoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78976412 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (2R)-2-[[2-cyanoethyl(2-methylpropyl)carbamoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)N(CCC#N)CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H25N3O3/c1-10(2)8-12(13(18)19)16-14(20)17(7-5-6-15)9-11(3)4/h10-12H,5,7-9H2,1-4H3,(H,16,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | GRSITHCDSYCHFE-GFCCVEGCSA-N |
| XLogP | 2.07 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |