C17H20OS — CID 78977116
2-[(3,5-dimethylphenyl)methylsulfanyl]-1-phenylethanol (PubChem CID 78977116) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfanyl]-1-phenylethanol.
| Compound Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-1-phenylethanol |
|---|---|
| PubChem CID | 78977116 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-1-phenylethanol |
| SMILES | Cc1cc(C)cc(CSCC(O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H20OS/c1-13-8-14(2)10-15(9-13)11-19-12-17(18)16-6-4-3-5-7-16/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | VFYONHVGMCIQDV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |