About ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate
ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate (PubChem CID 78977690) has the molecular formula C11H17F3N2O3
and a molecular weight of 282.26 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate |
| PubChem CID | 78977690 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)NCC(F)(F)F)CC(=O)OCC |
| InChI | InChI=1S/C11H17F3N2O3/c1-3-5-16(7-10(18)19-4-2)6-9(17)15-8-11(12,13)14/h3H,1,4-8H2,2H3,(H,15,17) |
| InChIKey | OTDGHUHDGNAAIT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate?
The IUPAC name of ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate (CID 78977690) is ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate.
What is the SMILES notation for ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate?
The canonical SMILES for ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate is C=CCN(CC(=O)NCC(F)(F)F)CC(=O)OCC.
What is the InChIKey of ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate?
The InChIKey is OTDGHUHDGNAAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O3/c1-3-5-16(7-10(18)19-4-2)6-9(17)15-8-11(12,13)14/h3H,1,4-8H2,2H3,(H,15,17).
What are the key properties of ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate?
ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate has a molecular weight of 282.26 g/mol, XLogP of 0.72, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetate is sourced from PubChem (CID 78977690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).