C15H22N4 — CID 78978020
(1S)-N-[(1-tert-butylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine (PubChem CID 78978020) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is (1S)-N-[(1-tert-butylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine.
| Compound Name | (1S)-N-[(1-tert-butylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 78978020 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (1S)-N-[(1-tert-butylpyrazol-4-yl)methyl]-1-pyridin-2-ylethanamine |
| SMILES | C[C@H](NCc1cnn(C(C)(C)C)c1)c1ccccn1 |
| InChI | InChI=1S/C15H22N4/c1-12(14-7-5-6-8-16-14)17-9-13-10-18-19(11-13)15(2,3)4/h5-8,10-12,17H,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | NTJWMFXXSMLWAZ-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |