About ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate
ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate (PubChem CID 78978746) has the molecular formula C12H13Br2NO3S
and a molecular weight of 411.12 g/mol. Its IUPAC name is ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate |
| PubChem CID | 78978746 |
| Molecular Formula | C12H13Br2NO3S |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 408.90 |
| IUPAC Name | ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H13Br2NO3S/c1-3-5-15(7-10(16)18-4-2)12(17)9-6-8(13)11(14)19-9/h3,6H,1,4-5,7H2,2H3 |
| InChIKey | HJRNAQYUSVEVLZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate?
The IUPAC name of ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate (CID 78978746) is ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate.
What is the SMILES notation for ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate?
The canonical SMILES for ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate is C=CCN(CC(=O)OCC)C(=O)c1cc(Br)c(Br)s1.
What is the InChIKey of ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate?
The InChIKey is HJRNAQYUSVEVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br2NO3S/c1-3-5-15(7-10(16)18-4-2)12(17)9-6-8(13)11(14)19-9/h3,6H,1,4-5,7H2,2H3.
What are the key properties of ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate?
ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate has a molecular weight of 411.12 g/mol, XLogP of 3.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4,5-dibromothiophene-2-carbonyl)-prop-2-enylamino]acetate is sourced from PubChem (CID 78978746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).