About 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine
4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine (PubChem CID 78982418) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine |
| PubChem CID | 78982418 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine |
| SMILES | CCCCN(C)c1cc(N)nc(N)n1 |
| InChI | InChI=1S/C9H17N5/c1-3-4-5-14(2)8-6-7(10)12-9(11)13-8/h6H,3-5H2,1-2H3,(H4,10,11,12,13) |
| InChIKey | RCILDJGWJUILSS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine?
The IUPAC name of 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine (CID 78982418) is 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine.
What is the SMILES notation for 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine?
The canonical SMILES for 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine is CCCCN(C)c1cc(N)nc(N)n1.
What is the InChIKey of 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine?
The InChIKey is RCILDJGWJUILSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5/c1-3-4-5-14(2)8-6-7(10)12-9(11)13-8/h6H,3-5H2,1-2H3,(H4,10,11,12,13).
What are the key properties of 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine?
4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine has a molecular weight of 195.27 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-butyl-4-N-methylpyrimidine-2,4,6-triamine is sourced from PubChem (CID 78982418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).