About 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one
4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one (PubChem CID 7898281) has the molecular formula C20H22NO4+
and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one.
Molecular Properties
| Compound Name | 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one |
| PubChem CID | 7898281 |
| Molecular Formula | C20H22NO4+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one |
| SMILES | C[C@H]1C[NH+](Cc2c(O)ccc3c2oc(=O)c2ccccc23)C[C@H](C)O1 |
| InChI | InChI=1S/C20H21NO4/c1-12-9-21(10-13(2)24-12)11-17-18(22)8-7-15-14-5-3-4-6-16(14)20(23)25-19(15)17/h3-8,12-13,22H,9-11H2,1-2H3/p+1/t12-,13-/m0/s1 |
| InChIKey | PDSWZIXYNCJANZ-STQMWFEESA-O |
| XLogP | 1.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one?
The IUPAC name of 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one (CID 7898281) is 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one.
What is the SMILES notation for 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one?
The canonical SMILES for 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one is C[C@H]1C[NH+](Cc2c(O)ccc3c2oc(=O)c2ccccc23)C[C@H](C)O1.
What is the InChIKey of 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one?
The InChIKey is PDSWZIXYNCJANZ-STQMWFEESA-O. The full InChI is InChI=1S/C20H21NO4/c1-12-9-21(10-13(2)24-12)11-17-18(22)8-7-15-14-5-3-4-6-16(14)20(23)25-19(15)17/h3-8,12-13,22H,9-11H2,1-2H3/p+1/t12-,13-/m0/s1.
What are the key properties of 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one?
4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one has a molecular weight of 340.40 g/mol, XLogP of 1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-hydroxybenzo[c]chromen-6-one is sourced from PubChem (CID 7898281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).