C9H12N4O2 — CID 78983105
5-oxo-N-(1H-pyrazol-5-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 78983105) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-oxo-N-(1H-pyrazol-5-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-(1H-pyrazol-5-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78983105 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-oxo-N-(1H-pyrazol-5-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)NCc2ccn[nH]2)CN1 |
| InChI | InChI=1S/C9H12N4O2/c14-8-3-6(4-10-8)9(15)11-5-7-1-2-12-13-7/h1-2,6H,3-5H2,(H,10,14)(H,11,15)(H,12,13) |
| InChIKey | WEFUIGANYZIRGM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |