C18H26N2 — CID 78983163
4-[[cyclopentyl(3-methylbutyl)amino]methyl]benzonitrile (PubChem CID 78983163) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-[[cyclopentyl(3-methylbutyl)amino]methyl]benzonitrile.
| Compound Name | 4-[[cyclopentyl(3-methylbutyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 78983163 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-[[cyclopentyl(3-methylbutyl)amino]methyl]benzonitrile |
| SMILES | CC(C)CCN(Cc1ccc(C#N)cc1)C1CCCC1 |
| InChI | InChI=1S/C18H26N2/c1-15(2)11-12-20(18-5-3-4-6-18)14-17-9-7-16(13-19)8-10-17/h7-10,15,18H,3-6,11-12,14H2,1-2H3 |
| InChIKey | DCQVWUWYKVRNCQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |