C14H14N4O6 — CID 7898424
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 7898424) has the molecular formula C14H14N4O6 and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7898424 |
| Molecular Formula | C14H14N4O6 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)Nc2cc([N+](=O)[O-])ccc2C)C1=O |
| InChI | InChI=1S/C14H14N4O6/c1-3-16-12(20)13(21)17(14(16)22)7-11(19)15-10-6-9(18(23)24)5-4-8(10)2/h4-6H,3,7H2,1-2H3,(H,15,19) |
| InChIKey | SDMVXVRGOAJCLL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|