C10H10N4O2S — CID 78985107
3-amino-5-methoxy-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 78985107) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-amino-5-methoxy-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-amino-5-methoxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 78985107 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-amino-5-methoxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | COc1cc(N)cc(C(=O)Nc2nncs2)c1 |
| InChI | InChI=1S/C10H10N4O2S/c1-16-8-3-6(2-7(11)4-8)9(15)13-10-14-12-5-17-10/h2-5H,11H2,1H3,(H,13,14,15) |
| InChIKey | HHBCXHFSTRBVDW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|