About methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate
methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate (PubChem CID 78985372) has the molecular formula C13H20N4O4
and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate |
| PubChem CID | 78985372 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate |
| SMILES | COC(=O)CCN1CCN(C(=O)C2=NNC(=O)CC2)CC1 |
| InChI | InChI=1S/C13H20N4O4/c1-21-12(19)4-5-16-6-8-17(9-7-16)13(20)10-2-3-11(18)15-14-10/h2-9H2,1H3,(H,15,18) |
| InChIKey | LVVZTEITUKNLAN-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate?
The IUPAC name of methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate (CID 78985372) is methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate.
What is the SMILES notation for methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate?
The canonical SMILES for methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate is COC(=O)CCN1CCN(C(=O)C2=NNC(=O)CC2)CC1.
What is the InChIKey of methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate?
The InChIKey is LVVZTEITUKNLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O4/c1-21-12(19)4-5-16-6-8-17(9-7-16)13(20)10-2-3-11(18)15-14-10/h2-9H2,1H3,(H,15,18).
What are the key properties of methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate?
methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate has a molecular weight of 296.33 g/mol, XLogP of -1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)piperazin-1-yl]propanoate is sourced from PubChem (CID 78985372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).