C15H22N2O3 — CID 78985735
2-[[(2R)-2-amino-3-phenylpropanoyl]-butan-2-ylamino]acetic acid (PubChem CID 78985735) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-phenylpropanoyl]-butan-2-ylamino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-phenylpropanoyl]-butan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 78985735 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[[(2R)-2-amino-3-phenylpropanoyl]-butan-2-ylamino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-3-11(2)17(10-14(18)19)15(20)13(16)9-12-7-5-4-6-8-12/h4-8,11,13H,3,9-10,16H2,1-2H3,(H,18,19)/t11?,13-/m1/s1 |
| InChIKey | FZCSADBWDFPQQT-GLGOKHISSA-N |
| XLogP | 1.27 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |