C15H13Br2NOS — CID 78986133
(4,5-dibromothiophen-2-yl)-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 78986133) has the molecular formula C15H13Br2NOS and a molecular weight of 415.15 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | (4,5-dibromothiophen-2-yl)-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 78986133 |
| Molecular Formula | C15H13Br2NOS |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)c(Br)s1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C15H13Br2NOS/c16-12-8-13(20-14(12)17)15(19)18-7-6-11(9-18)10-4-2-1-3-5-10/h1-5,8,11H,6-7,9H2 |
| InChIKey | HMYDXNZFDXTNJL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |