About (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide
(3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide (PubChem CID 78986249) has the molecular formula C7H8Br2N2O2
and a molecular weight of 311.96 g/mol. Its IUPAC name is (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide.
Molecular Properties
| Compound Name | (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide |
| PubChem CID | 78986249 |
| Molecular Formula | C7H8Br2N2O2 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide |
| SMILES | NC(=O)C[C@H](N)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C7H8Br2N2O2/c8-3-1-5(13-7(3)9)4(10)2-6(11)12/h1,4H,2,10H2,(H2,11,12)/t4-/m0/s1 |
| InChIKey | DYOSBHJXCZTPTC-BYPYZUCNSA-N |
| XLogP | 1.68 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide?
The IUPAC name of (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide (CID 78986249) is (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide.
What is the SMILES notation for (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide?
The canonical SMILES for (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide is NC(=O)C[C@H](N)c1cc(Br)c(Br)o1.
What is the InChIKey of (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide?
The InChIKey is DYOSBHJXCZTPTC-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H8Br2N2O2/c8-3-1-5(13-7(3)9)4(10)2-6(11)12/h1,4H,2,10H2,(H2,11,12)/t4-/m0/s1.
What are the key properties of (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide?
(3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide has a molecular weight of 311.96 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-3-(4,5-dibromofuran-2-yl)propanamide is sourced from PubChem (CID 78986249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).