About 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile
3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile (PubChem CID 78988221) has the molecular formula C13H15F2N3
and a molecular weight of 251.28 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
| PubChem CID | 78988221 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
| SMILES | CN1CCCN(c2c(F)cc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C13H15F2N3/c1-17-3-2-4-18(6-5-17)13-11(14)7-10(9-16)8-12(13)15/h7-8H,2-6H2,1H3 |
| InChIKey | DXSWNDOLIURYFO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile?
The IUPAC name of 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile (CID 78988221) is 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile.
What is the SMILES notation for 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile?
The canonical SMILES for 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile is CN1CCCN(c2c(F)cc(C#N)cc2F)CC1.
What is the InChIKey of 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile?
The InChIKey is DXSWNDOLIURYFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3/c1-17-3-2-4-18(6-5-17)13-11(14)7-10(9-16)8-12(13)15/h7-8H,2-6H2,1H3.
What are the key properties of 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile?
3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile has a molecular weight of 251.28 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-(4-methyl-1,4-diazepan-1-yl)benzonitrile is sourced from PubChem (CID 78988221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).