C13H14F2N2O — CID 78988384
3,5-difluoro-4-(oxan-3-ylmethylamino)benzonitrile (PubChem CID 78988384) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 3,5-difluoro-4-(oxan-3-ylmethylamino)benzonitrile.
| Compound Name | 3,5-difluoro-4-(oxan-3-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 78988384 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3,5-difluoro-4-(oxan-3-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cc(F)c(NCC2CCCOC2)c(F)c1 |
| InChI | InChI=1S/C13H14F2N2O/c14-11-4-10(6-16)5-12(15)13(11)17-7-9-2-1-3-18-8-9/h4-5,9,17H,1-3,7-8H2 |
| InChIKey | FQCXJTRVUKQVRU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |