About N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide
N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide (PubChem CID 78988652) has the molecular formula C9H13F3N4O
and a molecular weight of 250.22 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide |
| PubChem CID | 78988652 |
| Molecular Formula | C9H13F3N4O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide |
| SMILES | CC(C)CN(CC(F)(F)F)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C9H13F3N4O/c1-6(2)4-16(5-9(10,11)12)8(17)7-3-13-15-14-7/h3,6H,4-5H2,1-2H3,(H,13,14,15) |
| InChIKey | AORNKUFMNMLUQS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide?
The IUPAC name of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide (CID 78988652) is N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide.
What is the SMILES notation for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide?
The canonical SMILES for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide is CC(C)CN(CC(F)(F)F)C(=O)c1cn[nH]n1.
What is the InChIKey of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide?
The InChIKey is AORNKUFMNMLUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N4O/c1-6(2)4-16(5-9(10,11)12)8(17)7-3-13-15-14-7/h3,6H,4-5H2,1-2H3,(H,13,14,15).
What are the key properties of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide?
N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide has a molecular weight of 250.22 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)-2H-triazole-4-carboxamide is sourced from PubChem (CID 78988652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).