About 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine
6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine (PubChem CID 78989037) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine |
| PubChem CID | 78989037 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine |
| SMILES | CC1CC(C)CN(c2cncc(N)n2)C1 |
| InChI | InChI=1S/C11H18N4/c1-8-3-9(2)7-15(6-8)11-5-13-4-10(12)14-11/h4-5,8-9H,3,6-7H2,1-2H3,(H2,12,14) |
| InChIKey | VTMDQXSWQNYOKN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine?
The IUPAC name of 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine (CID 78989037) is 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine.
What is the SMILES notation for 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine?
The canonical SMILES for 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine is CC1CC(C)CN(c2cncc(N)n2)C1.
What is the InChIKey of 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine?
The InChIKey is VTMDQXSWQNYOKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-8-3-9(2)7-15(6-8)11-5-13-4-10(12)14-11/h4-5,8-9H,3,6-7H2,1-2H3,(H2,12,14).
What are the key properties of 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine?
6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine has a molecular weight of 206.29 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethylpiperidin-1-yl)pyrazin-2-amine is sourced from PubChem (CID 78989037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).