C16H31N3O2 — CID 78989733
1-hexoxy-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]propan-2-ol (PubChem CID 78989733) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-hexoxy-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]propan-2-ol.
| Compound Name | 1-hexoxy-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 78989733 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 1-hexoxy-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]propan-2-ol |
| SMILES | CCCCCCOCC(O)CNCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C16H31N3O2/c1-5-6-7-8-9-21-12-15(20)10-17-11-16-13(2)18-19(4)14(16)3/h15,17,20H,5-12H2,1-4H3 |
| InChIKey | XACDYAUXQCHBPC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|