About N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine
N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine (PubChem CID 78990177) has the molecular formula C9H11N5S2
and a molecular weight of 253.36 g/mol. Its IUPAC name is N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine |
| PubChem CID | 78990177 |
| Molecular Formula | C9H11N5S2 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine |
| SMILES | CCNc1cncc(Sc2nnc(C)s2)n1 |
| InChI | InChI=1S/C9H11N5S2/c1-3-11-7-4-10-5-8(12-7)16-9-14-13-6(2)15-9/h4-5H,3H2,1-2H3,(H,11,12) |
| InChIKey | OBGDJQDYQFFESB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine?
The IUPAC name of N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine (CID 78990177) is N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine.
What is the SMILES notation for N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine?
The canonical SMILES for N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine is CCNc1cncc(Sc2nnc(C)s2)n1.
What is the InChIKey of N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine?
The InChIKey is OBGDJQDYQFFESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5S2/c1-3-11-7-4-10-5-8(12-7)16-9-14-13-6(2)15-9/h4-5H,3H2,1-2H3,(H,11,12).
What are the key properties of N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine?
N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine has a molecular weight of 253.36 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazin-2-amine is sourced from PubChem (CID 78990177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).