C13H18N6S — CID 78990311
N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine (PubChem CID 78990311) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine.
| Compound Name | N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 78990311 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrazin-2-amine |
| SMILES | CCNc1cncc(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C13H18N6S/c1-2-15-10-8-14-9-12(16-10)20-13-18-17-11-6-4-3-5-7-19(11)13/h8-9H,2-7H2,1H3,(H,15,16) |
| InChIKey | HTIMEPYZWXPYQB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |