C12H12F3NO3S — CID 78990464
2-[3-(5-methylthiophen-2-yl)prop-2-enoyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 78990464) has the molecular formula C12H12F3NO3S and a molecular weight of 307.29 g/mol. Its IUPAC name is 2-[3-(5-methylthiophen-2-yl)prop-2-enoyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[3-(5-methylthiophen-2-yl)prop-2-enoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 78990464 |
| Molecular Formula | C12H12F3NO3S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[3-(5-methylthiophen-2-yl)prop-2-enoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | Cc1ccc(C=CC(=O)N(CC(=O)O)CC(F)(F)F)s1 |
| InChI | InChI=1S/C12H12F3NO3S/c1-8-2-3-9(20-8)4-5-10(17)16(6-11(18)19)7-12(13,14)15/h2-5H,6-7H2,1H3,(H,18,19) |
| InChIKey | PHAVHGIMXSMNEH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|