About 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol
2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol (PubChem CID 78990642) has the molecular formula C10H20N4O
and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol |
| PubChem CID | 78990642 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol |
| SMILES | CCCCN(CCO)Cc1nncn1C |
| InChI | InChI=1S/C10H20N4O/c1-3-4-5-14(6-7-15)8-10-12-11-9-13(10)2/h9,15H,3-8H2,1-2H3 |
| InChIKey | LBEHZZUXNLUTNO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol?
The IUPAC name of 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol (CID 78990642) is 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol.
What is the SMILES notation for 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol?
The canonical SMILES for 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol is CCCCN(CCO)Cc1nncn1C.
What is the InChIKey of 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol?
The InChIKey is LBEHZZUXNLUTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O/c1-3-4-5-14(6-7-15)8-10-12-11-9-13(10)2/h9,15H,3-8H2,1-2H3.
What are the key properties of 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol?
2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol has a molecular weight of 212.30 g/mol, XLogP of 0.41, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]ethanol is sourced from PubChem (CID 78990642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).