C16H25N3O — CID 78991041
N-cyclopropyl-2-hydrazinyl-5-methyl-N-(3-methylbutyl)benzamide (PubChem CID 78991041) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is N-cyclopropyl-2-hydrazinyl-5-methyl-N-(3-methylbutyl)benzamide.
| Compound Name | N-cyclopropyl-2-hydrazinyl-5-methyl-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 78991041 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-cyclopropyl-2-hydrazinyl-5-methyl-N-(3-methylbutyl)benzamide |
| SMILES | Cc1ccc(NN)c(C(=O)N(CCC(C)C)C2CC2)c1 |
| InChI | InChI=1S/C16H25N3O/c1-11(2)8-9-19(13-5-6-13)16(20)14-10-12(3)4-7-15(14)18-17/h4,7,10-11,13,18H,5-6,8-9,17H2,1-3H3 |
| InChIKey | VEBNGCYWHHGINI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|