About 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine
1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine (PubChem CID 78991257) has the molecular formula C17H27BrN2
and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine |
| PubChem CID | 78991257 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine |
| SMILES | CC(C)CCN(CCC(N)c1ccc(Br)cc1)C1CC1 |
| InChI | InChI=1S/C17H27BrN2/c1-13(2)9-11-20(16-7-8-16)12-10-17(19)14-3-5-15(18)6-4-14/h3-6,13,16-17H,7-12,19H2,1-2H3 |
| InChIKey | HTAMPKNGYVGYOU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine?
The IUPAC name of 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine (CID 78991257) is 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine.
What is the SMILES notation for 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine?
The canonical SMILES for 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine is CC(C)CCN(CCC(N)c1ccc(Br)cc1)C1CC1.
What is the InChIKey of 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine?
The InChIKey is HTAMPKNGYVGYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27BrN2/c1-13(2)9-11-20(16-7-8-16)12-10-17(19)14-3-5-15(18)6-4-14/h3-6,13,16-17H,7-12,19H2,1-2H3.
What are the key properties of 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine?
1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine has a molecular weight of 339.32 g/mol, XLogP of 4.35, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-N'-cyclopropyl-N'-(3-methylbutyl)propane-1,3-diamine is sourced from PubChem (CID 78991257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).