C11H11F3N2O — CID 78992106
(NZ)-N-[1-(2,2,2-trifluoroethyl)-2,3-dihydroquinolin-4-ylidene]hydroxylamine (PubChem CID 78992106) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is (NZ)-N-[1-(2,2,2-trifluoroethyl)-2,3-dihydroquinolin-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2,2,2-trifluoroethyl)-2,3-dihydroquinolin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 78992106 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (NZ)-N-[1-(2,2,2-trifluoroethyl)-2,3-dihydroquinolin-4-ylidene]hydroxylamine |
| SMILES | O/N=C1/CCN(CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)7-16-6-5-9(15-17)8-3-1-2-4-10(8)16/h1-4,17H,5-7H2/b15-9- |
| InChIKey | KNLNLSWODONOSC-DHDCSXOGSA-N |
| XLogP | 2.64 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|