About (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate (PubChem CID 7899292) has the molecular formula C18H17N3O5S
and a molecular weight of 387.42 g/mol. Its IUPAC name is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate |
| PubChem CID | 7899292 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate |
| SMILES | COc1cccc(C(=O)NCC(=O)OCc2cc(=O)n3c(C)csc3n2)c1 |
| InChI | InChI=1S/C18H17N3O5S/c1-11-10-27-18-20-13(7-15(22)21(11)18)9-26-16(23)8-19-17(24)12-4-3-5-14(6-12)25-2/h3-7,10H,8-9H2,1-2H3,(H,19,24) |
| InChIKey | QSDTWQSMNQXGOM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate?
The IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate (CID 7899292) is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate.
What is the SMILES notation for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate?
The canonical SMILES for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate is COc1cccc(C(=O)NCC(=O)OCc2cc(=O)n3c(C)csc3n2)c1.
What is the InChIKey of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate?
The InChIKey is QSDTWQSMNQXGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O5S/c1-11-10-27-18-20-13(7-15(22)21(11)18)9-26-16(23)8-19-17(24)12-4-3-5-14(6-12)25-2/h3-7,10H,8-9H2,1-2H3,(H,19,24).
What are the key properties of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate?
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate has a molecular weight of 387.42 g/mol, XLogP of 1.55, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-[(3-methoxybenzoyl)amino]acetate is sourced from PubChem (CID 7899292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).