C14H11BrF2O2 — CID 78993100
[5-bromo-2-[(3,4-difluorophenyl)methoxy]phenyl]methanol (PubChem CID 78993100) has the molecular formula C14H11BrF2O2 and a molecular weight of 329.14 g/mol. Its IUPAC name is [5-bromo-2-[(3,4-difluorophenyl)methoxy]phenyl]methanol.
| Compound Name | [5-bromo-2-[(3,4-difluorophenyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 78993100 |
| Molecular Formula | C14H11BrF2O2 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | [5-bromo-2-[(3,4-difluorophenyl)methoxy]phenyl]methanol |
| SMILES | OCc1cc(Br)ccc1OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11BrF2O2/c15-11-2-4-14(10(6-11)7-18)19-8-9-1-3-12(16)13(17)5-9/h1-6,18H,7-8H2 |
| InChIKey | BNBPWNPFUIQZOZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |