C10H11ClN4O4 — CID 78993882
N-[2-(carbamoylamino)ethyl]-2-chloro-4-nitrobenzamide (PubChem CID 78993882) has the molecular formula C10H11ClN4O4 and a molecular weight of 286.68 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2-chloro-4-nitrobenzamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 78993882 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2-chloro-4-nitrobenzamide |
| SMILES | NC(=O)NCCNC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H11ClN4O4/c11-8-5-6(15(18)19)1-2-7(8)9(16)13-3-4-14-10(12)17/h1-2,5H,3-4H2,(H,13,16)(H3,12,14,17) |
| InChIKey | CRNOZPJCHNIOKZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|