C15H22ClNO2 — CID 78994299
ethyl 2-[(3-chlorophenyl)methyl-methylamino]pentanoate (PubChem CID 78994299) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is ethyl 2-[(3-chlorophenyl)methyl-methylamino]pentanoate.
| Compound Name | ethyl 2-[(3-chlorophenyl)methyl-methylamino]pentanoate |
|---|---|
| PubChem CID | 78994299 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | ethyl 2-[(3-chlorophenyl)methyl-methylamino]pentanoate |
| SMILES | CCCC(C(=O)OCC)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO2/c1-4-7-14(15(18)19-5-2)17(3)11-12-8-6-9-13(16)10-12/h6,8-10,14H,4-5,7,11H2,1-3H3 |
| InChIKey | PRPLMZZWOGSTTK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |