About 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile
1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile (PubChem CID 78994527) has the molecular formula C12H16F3N3O
and a molecular weight of 275.27 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile |
| PubChem CID | 78994527 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile |
| SMILES | N#CC1(C(=O)N2CCN(CC(F)(F)F)CC2)CCC1 |
| InChI | InChI=1S/C12H16F3N3O/c13-12(14,15)9-17-4-6-18(7-5-17)10(19)11(8-16)2-1-3-11/h1-7,9H2 |
| InChIKey | HHNPZJOOHWYOSP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile?
The IUPAC name of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile (CID 78994527) is 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile.
What is the SMILES notation for 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile?
The canonical SMILES for 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile is N#CC1(C(=O)N2CCN(CC(F)(F)F)CC2)CCC1.
What is the InChIKey of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile?
The InChIKey is HHNPZJOOHWYOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O/c13-12(14,15)9-17-4-6-18(7-5-17)10(19)11(8-16)2-1-3-11/h1-7,9H2.
What are the key properties of 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile?
1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile has a molecular weight of 275.27 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]cyclobutane-1-carbonitrile is sourced from PubChem (CID 78994527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).