C11H11BrN2OS — CID 78994573
N-[(3-bromothiophen-2-yl)methyl]-1-cyanocyclobutane-1-carboxamide (PubChem CID 78994573) has the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-1-cyanocyclobutane-1-carboxamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-1-cyanocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 78994573 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-1-cyanocyclobutane-1-carboxamide |
| SMILES | N#CC1(C(=O)NCc2sccc2Br)CCC1 |
| InChI | InChI=1S/C11H11BrN2OS/c12-8-2-5-16-9(8)6-14-10(15)11(7-13)3-1-4-11/h2,5H,1,3-4,6H2,(H,14,15) |
| InChIKey | LMBPFXUAFBLGMS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |