About 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide
1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide (PubChem CID 78994872) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide |
| PubChem CID | 78994872 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide |
| SMILES | Cc1cnc(NC(=O)C2(C#N)CCC2)s1 |
| InChI | InChI=1S/C10H11N3OS/c1-7-5-12-9(15-7)13-8(14)10(6-11)3-2-4-10/h5H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | BNJMKOLGVRNHMC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide?
The IUPAC name of 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide (CID 78994872) is 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide is Cc1cnc(NC(=O)C2(C#N)CCC2)s1.
What is the InChIKey of 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide?
The InChIKey is BNJMKOLGVRNHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-7-5-12-9(15-7)13-8(14)10(6-11)3-2-4-10/h5H,2-4H2,1H3,(H,12,13,14).
What are the key properties of 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide?
1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide has a molecular weight of 221.28 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(5-methyl-1,3-thiazol-2-yl)cyclobutane-1-carboxamide is sourced from PubChem (CID 78994872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).