C17H22N2OS — CID 78995785
(2S)-2-amino-N-[1-(5-methylthiophen-2-yl)propan-2-yl]-3-phenylpropanamide (PubChem CID 78995785) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(5-methylthiophen-2-yl)propan-2-yl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[1-(5-methylthiophen-2-yl)propan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 78995785 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S)-2-amino-N-[1-(5-methylthiophen-2-yl)propan-2-yl]-3-phenylpropanamide |
| SMILES | Cc1ccc(CC(C)NC(=O)[C@@H](N)Cc2ccccc2)s1 |
| InChI | InChI=1S/C17H22N2OS/c1-12(10-15-9-8-13(2)21-15)19-17(20)16(18)11-14-6-4-3-5-7-14/h3-9,12,16H,10-11,18H2,1-2H3,(H,19,20)/t12?,16-/m0/s1 |
| InChIKey | CCDGXLYOGLAGBE-INSVYWFGSA-N |
| XLogP | 2.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |