C11H14F3N3O4 — CID 78995893
7-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78995893) has the molecular formula C11H14F3N3O4 and a molecular weight of 309.24 g/mol. Its IUPAC name is 7-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78995893 |
| Molecular Formula | C11H14F3N3O4 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 7-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)CCOCC(F)(F)F)C2)N1 |
| InChI | InChI=1S/C11H14F3N3O4/c12-11(13,14)6-21-4-1-7(18)17-3-2-10(5-17)8(19)15-9(20)16-10/h1-6H2,(H2,15,16,19,20) |
| InChIKey | RHASJSGJZMDCMH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|