C13H15N5O3 — CID 78995944
7-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78995944) has the molecular formula C13H15N5O3 and a molecular weight of 289.29 g/mol. Its IUPAC name is 7-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78995944 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 7-[(E)-3-(1-methylpyrazol-4-yl)prop-2-enoyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cn1cc(/C=C/C(=O)N2CCC3(C2)NC(=O)NC3=O)cn1 |
| InChI | InChI=1S/C13H15N5O3/c1-17-7-9(6-14-17)2-3-10(19)18-5-4-13(8-18)11(20)15-12(21)16-13/h2-3,6-7H,4-5,8H2,1H3,(H2,15,16,20,21)/b3-2+ |
| InChIKey | YNFFHGPIVFQBLX-NSCUHMNNSA-N |
| XLogP | -0.76 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|