C11H13N5O4 — CID 78996258
7-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78996258) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is 7-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78996258 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 7-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1CCC(C(=O)N2CCC3(C2)NC(=O)NC3=O)=NN1 |
| InChI | InChI=1S/C11H13N5O4/c17-7-2-1-6(14-15-7)8(18)16-4-3-11(5-16)9(19)12-10(20)13-11/h1-5H2,(H,15,17)(H2,12,13,19,20) |
| InChIKey | UKUSLNTUMICMII-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|