C10H10ClN3O4S2 — CID 78996269
7-(5-chlorothiophen-2-yl)sulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78996269) has the molecular formula C10H10ClN3O4S2 and a molecular weight of 335.79 g/mol. Its IUPAC name is 7-(5-chlorothiophen-2-yl)sulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(5-chlorothiophen-2-yl)sulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78996269 |
| Molecular Formula | C10H10ClN3O4S2 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 7-(5-chlorothiophen-2-yl)sulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(S(=O)(=O)c3ccc(Cl)s3)C2)N1 |
| InChI | InChI=1S/C10H10ClN3O4S2/c11-6-1-2-7(19-6)20(17,18)14-4-3-10(5-14)8(15)12-9(16)13-10/h1-2H,3-5H2,(H2,12,13,15,16) |
| InChIKey | YUEXIRZQQPTEGE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|