C12H14N4O4S — CID 78996483
7-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78996483) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 7-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78996483 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 7-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1csc(=O)n1CC(=O)N1CCC2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C12H14N4O4S/c1-7-5-21-11(20)16(7)4-8(17)15-3-2-12(6-15)9(18)13-10(19)14-12/h5H,2-4,6H2,1H3,(H2,13,14,18,19) |
| InChIKey | UCSPCJUOUOZORF-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|