About 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine
4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine (PubChem CID 78996561) has the molecular formula C12H13F3N2S
and a molecular weight of 274.31 g/mol. Its IUPAC name is 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine.
Molecular Properties
| Compound Name | 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine |
| PubChem CID | 78996561 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine |
| SMILES | CSc1cc(N)cc2c1ccn2CCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2S/c1-18-11-7-8(16)6-10-9(11)2-4-17(10)5-3-12(13,14)15/h2,4,6-7H,3,5,16H2,1H3 |
| InChIKey | REPHDTIWTZGPKA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine?
The IUPAC name of 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine (CID 78996561) is 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine.
What is the SMILES notation for 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine?
The canonical SMILES for 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine is CSc1cc(N)cc2c1ccn2CCC(F)(F)F.
What is the InChIKey of 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine?
The InChIKey is REPHDTIWTZGPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2S/c1-18-11-7-8(16)6-10-9(11)2-4-17(10)5-3-12(13,14)15/h2,4,6-7H,3,5,16H2,1H3.
What are the key properties of 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine?
4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine has a molecular weight of 274.31 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-1-(3,3,3-trifluoropropyl)indol-6-amine is sourced from PubChem (CID 78996561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).