About 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline
4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline (PubChem CID 78997204) has the molecular formula C11H14BrNO2
and a molecular weight of 272.14 g/mol. Its IUPAC name is 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline.
Molecular Properties
| Compound Name | 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline |
| PubChem CID | 78997204 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline |
| SMILES | Brc1ccc(NCC2CCOCO2)cc1 |
| InChI | InChI=1S/C11H14BrNO2/c12-9-1-3-10(4-2-9)13-7-11-5-6-14-8-15-11/h1-4,11,13H,5-8H2 |
| InChIKey | AHTVSRTUPLIHIH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline?
The IUPAC name of 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline (CID 78997204) is 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline.
What is the SMILES notation for 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline?
The canonical SMILES for 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline is Brc1ccc(NCC2CCOCO2)cc1.
What is the InChIKey of 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline?
The InChIKey is AHTVSRTUPLIHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO2/c12-9-1-3-10(4-2-9)13-7-11-5-6-14-8-15-11/h1-4,11,13H,5-8H2.
What are the key properties of 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline?
4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline has a molecular weight of 272.14 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(1,3-dioxan-4-ylmethyl)aniline is sourced from PubChem (CID 78997204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).