C12H12F2N2O4 — CID 78997229
4,5-difluoro-N-methyl-2-nitro-N-(oxolan-3-yl)benzamide (PubChem CID 78997229) has the molecular formula C12H12F2N2O4 and a molecular weight of 286.23 g/mol. Its IUPAC name is 4,5-difluoro-N-methyl-2-nitro-N-(oxolan-3-yl)benzamide.
| Compound Name | 4,5-difluoro-N-methyl-2-nitro-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 78997229 |
| Molecular Formula | C12H12F2N2O4 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4,5-difluoro-N-methyl-2-nitro-N-(oxolan-3-yl)benzamide |
| SMILES | CN(C(=O)c1cc(F)c(F)cc1[N+](=O)[O-])C1CCOC1 |
| InChI | InChI=1S/C12H12F2N2O4/c1-15(7-2-3-20-6-7)12(17)8-4-9(13)10(14)5-11(8)16(18)19/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | VTCXNYIZWAJPJR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|